refactor: move brother_node development artifact to dev/test-nodes subdirectory

Development Artifact Cleanup:
✅ BROTHER_NODE REORGANIZATION: Moved development test node to appropriate location
- dev/test-nodes/brother_node/: Moved from root directory for better organization
- Contains development configuration, test logs, and test chain data
- No impact on production systems - purely development/testing artifact

✅ DEVELOPMENT ARTIFACTS IDENTIFIED:
- Chain ID: aitbc-brother-chain (test/development chain)
- Ports: 8010 (P2P) and 8011 (RPC) - different from production
- Environment: .env file with test configuration
- Logs: rpc.log and node.log from development testing session (March 15, 2026)

✅ ROOT DIRECTORY CLEANUP: Removed development clutter from production directory
- brother_node/ moved to dev/test-nodes/brother_node/
- Root directory now contains only production-ready components
- Development artifacts properly organized in dev/ subdirectory

DIRECTORY STRUCTURE IMPROVEMENT:
📁 dev/test-nodes/: Development and testing node configurations
🏗️ Root Directory: Clean production structure with only essential components
🧪 Development Isolation: Test environments separated from production

BENEFITS:
✅ Clean Production Directory: No development artifacts in root
✅ Better Organization: Development nodes grouped in dev/ subdirectory
✅ Clear Separation: Production vs development environments clearly distinguished
✅ Maintainability: Easier to identify and manage development components

RESULT: Successfully moved brother_node development artifact to dev/test-nodes/ subdirectory, cleaning up the root directory while preserving development testing environment for future use.

dev/env/cli_env/lib/python3.13/site-packages/rich/palette.py

@@ -0,0 +1,100 @@
+from math import sqrt
+from functools import lru_cache
+from typing import Sequence, Tuple, TYPE_CHECKING
+
+from .color_triplet import ColorTriplet
+
+if TYPE_CHECKING:
+    from rich.table import Table
+
+
+class Palette:
+    """A palette of available colors."""
+
+    def __init__(self, colors: Sequence[Tuple[int, int, int]]):
+        self._colors = colors
+
+    def __getitem__(self, number: int) -> ColorTriplet:
+        return ColorTriplet(*self._colors[number])
+
+    def __rich__(self) -> "Table":
+        from rich.color import Color
+        from rich.style import Style
+        from rich.text import Text
+        from rich.table import Table
+
+        table = Table(
+            "index",
+            "RGB",
+            "Color",
+            title="Palette",
+            caption=f"{len(self._colors)} colors",
+            highlight=True,
+            caption_justify="right",
+        )
+        for index, color in enumerate(self._colors):
+            table.add_row(
+                str(index),
+                repr(color),
+                Text(" " * 16, style=Style(bgcolor=Color.from_rgb(*color))),
+            )
+        return table
+
+    # This is somewhat inefficient and needs caching
+    @lru_cache(maxsize=1024)
+    def match(self, color: Tuple[int, int, int]) -> int:
+        """Find a color from a palette that most closely matches a given color.
+
+        Args:
+            color (Tuple[int, int, int]): RGB components in range 0 > 255.
+
+        Returns:
+            int: Index of closes matching color.
+        """
+        red1, green1, blue1 = color
+        _sqrt = sqrt
+        get_color = self._colors.__getitem__
+
+        def get_color_distance(index: int) -> float:
+            """Get the distance to a color."""
+            red2, green2, blue2 = get_color(index)
+            red_mean = (red1 + red2) // 2
+            red = red1 - red2
+            green = green1 - green2
+            blue = blue1 - blue2
+            return _sqrt(
+                (((512 + red_mean) * red * red) >> 8)
+                + 4 * green * green
+                + (((767 - red_mean) * blue * blue) >> 8)
+            )
+
+        min_index = min(range(len(self._colors)), key=get_color_distance)
+        return min_index
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import colorsys
+    from typing import Iterable
+    from rich.color import Color
+    from rich.console import Console, ConsoleOptions
+    from rich.segment import Segment
+    from rich.style import Style
+
+    class ColorBox:
+        def __rich_console__(
+            self, console: Console, options: ConsoleOptions
+        ) -> Iterable[Segment]:
+            height = console.size.height - 3
+            for y in range(0, height):
+                for x in range(options.max_width):
+                    h = x / options.max_width
+                    l = y / (height + 1)
+                    r1, g1, b1 = colorsys.hls_to_rgb(h, l, 1.0)
+                    r2, g2, b2 = colorsys.hls_to_rgb(h, l + (1 / height / 2), 1.0)
+                    bgcolor = Color.from_rgb(r1 * 255, g1 * 255, b1 * 255)
+                    color = Color.from_rgb(r2 * 255, g2 * 255, b2 * 255)
+                    yield Segment("▄", Style(color=color, bgcolor=bgcolor))
+                yield Segment.line()
+
+    console = Console()
+    console.print(ColorBox())